C17H15NO4S — CID 17454387
(3-methoxyphenyl)methyl 3-oxo-4H-1,4-benzothiazine-6-carboxylate (PubChem CID 17454387) has the molecular formula C17H15NO4S and a molecular weight of 329.38 g/mol. Its IUPAC name is (3-methoxyphenyl)methyl 3-oxo-4H-1,4-benzothiazine-6-carboxylate.
| Compound Name | (3-methoxyphenyl)methyl 3-oxo-4H-1,4-benzothiazine-6-carboxylate |
|---|---|
| PubChem CID | 17454387 |
| Molecular Formula | C17H15NO4S |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | (3-methoxyphenyl)methyl 3-oxo-4H-1,4-benzothiazine-6-carboxylate |
| SMILES | COc1cccc(COC(=O)c2ccc3c(c2)NC(=O)CS3)c1 |
| InChI | InChI=1S/C17H15NO4S/c1-21-13-4-2-3-11(7-13)9-22-17(20)12-5-6-15-14(8-12)18-16(19)10-23-15/h2-8H,9-10H2,1H3,(H,18,19) |
| InChIKey | IIPJFRMTESKBDR-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |