C16H13NO3S — CID 51149547
(3-methylphenyl) 3-oxo-4H-1,4-benzothiazine-6-carboxylate (PubChem CID 51149547) has the molecular formula C16H13NO3S and a molecular weight of 299.35 g/mol. Its IUPAC name is (3-methylphenyl) 3-oxo-4H-1,4-benzothiazine-6-carboxylate.
| Compound Name | (3-methylphenyl) 3-oxo-4H-1,4-benzothiazine-6-carboxylate |
|---|---|
| PubChem CID | 51149547 |
| Molecular Formula | C16H13NO3S |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | (3-methylphenyl) 3-oxo-4H-1,4-benzothiazine-6-carboxylate |
| SMILES | Cc1cccc(OC(=O)c2ccc3c(c2)NC(=O)CS3)c1 |
| InChI | InChI=1S/C16H13NO3S/c1-10-3-2-4-12(7-10)20-16(19)11-5-6-14-13(8-11)17-15(18)9-21-14/h2-8H,9H2,1H3,(H,17,18) |
| InChIKey | WUFCRIDKPHMPEH-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|