C17H16N2O4S — CID 46798733
N-(2,5-dimethoxyphenyl)-3-oxo-4H-1,4-benzothiazine-6-carboxamide (PubChem CID 46798733) has the molecular formula C17H16N2O4S and a molecular weight of 344.39 g/mol. Its IUPAC name is N-(2,5-dimethoxyphenyl)-3-oxo-4H-1,4-benzothiazine-6-carboxamide.
| Compound Name | N-(2,5-dimethoxyphenyl)-3-oxo-4H-1,4-benzothiazine-6-carboxamide |
|---|---|
| PubChem CID | 46798733 |
| Molecular Formula | C17H16N2O4S |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | N-(2,5-dimethoxyphenyl)-3-oxo-4H-1,4-benzothiazine-6-carboxamide |
| SMILES | COc1ccc(OC)c(NC(=O)c2ccc3c(c2)NC(=O)CS3)c1 |
| InChI | InChI=1S/C17H16N2O4S/c1-22-11-4-5-14(23-2)12(8-11)19-17(21)10-3-6-15-13(7-10)18-16(20)9-24-15/h3-8H,9H2,1-2H3,(H,18,20)(H,19,21) |
| InChIKey | PJLFMSBETUGNOU-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |