About (3-methoxyphenyl)methyl 2-amino-3-bromobenzoate
(3-methoxyphenyl)methyl 2-amino-3-bromobenzoate (PubChem CID 61235590) has the molecular formula C15H14BrNO3
and a molecular weight of 336.19 g/mol. Its IUPAC name is (3-methoxyphenyl)methyl 2-amino-3-bromobenzoate.
Molecular Properties
| Compound Name | (3-methoxyphenyl)methyl 2-amino-3-bromobenzoate |
| PubChem CID | 61235590 |
| Molecular Formula | C15H14BrNO3 |
| Molecular Weight | 336.19 g/mol |
| Exact Mass | 335.02 |
| IUPAC Name | (3-methoxyphenyl)methyl 2-amino-3-bromobenzoate |
| SMILES | COc1cccc(COC(=O)c2cccc(Br)c2N)c1 |
| InChI | InChI=1S/C15H14BrNO3/c1-19-11-5-2-4-10(8-11)9-20-15(18)12-6-3-7-13(16)14(12)17/h2-8H,9,17H2,1H3 |
| InChIKey | BSHJEBDFKNHSRE-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.19 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (3-methoxyphenyl)methyl 2-amino-3-bromobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methoxyphenyl)methyl 2-amino-3-bromobenzoate?
The IUPAC name of (3-methoxyphenyl)methyl 2-amino-3-bromobenzoate (CID 61235590) is (3-methoxyphenyl)methyl 2-amino-3-bromobenzoate.
What is the SMILES notation for (3-methoxyphenyl)methyl 2-amino-3-bromobenzoate?
The canonical SMILES for (3-methoxyphenyl)methyl 2-amino-3-bromobenzoate is COc1cccc(COC(=O)c2cccc(Br)c2N)c1.
What is the InChIKey of (3-methoxyphenyl)methyl 2-amino-3-bromobenzoate?
The InChIKey is BSHJEBDFKNHSRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14BrNO3/c1-19-11-5-2-4-10(8-11)9-20-15(18)12-6-3-7-13(16)14(12)17/h2-8H,9,17H2,1H3.
What are the key properties of (3-methoxyphenyl)methyl 2-amino-3-bromobenzoate?
(3-methoxyphenyl)methyl 2-amino-3-bromobenzoate has a molecular weight of 336.19 g/mol, XLogP of 3.40, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methoxyphenyl)methyl 2-amino-3-bromobenzoate is sourced from PubChem (CID 61235590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).