C14H11Cl2NO3 — CID 114929160
(3-methoxyphenyl)methyl 2,5-dichloropyridine-4-carboxylate (PubChem CID 114929160) has the molecular formula C14H11Cl2NO3 and a molecular weight of 312.15 g/mol. Its IUPAC name is (3-methoxyphenyl)methyl 2,5-dichloropyridine-4-carboxylate.
| Compound Name | (3-methoxyphenyl)methyl 2,5-dichloropyridine-4-carboxylate |
|---|---|
| PubChem CID | 114929160 |
| Molecular Formula | C14H11Cl2NO3 |
| Molecular Weight | 312.15 g/mol |
| Exact Mass | 311.01 |
| IUPAC Name | (3-methoxyphenyl)methyl 2,5-dichloropyridine-4-carboxylate |
| SMILES | COc1cccc(COC(=O)c2cc(Cl)ncc2Cl)c1 |
| InChI | InChI=1S/C14H11Cl2NO3/c1-19-10-4-2-3-9(5-10)8-20-14(18)11-6-13(16)17-7-12(11)15/h2-7H,8H2,1H3 |
| InChIKey | HNNJTBXIWDBLBV-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.15 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|