C16H17NO6S — CID 16570421
(3-methoxyphenyl)methyl 2-methoxy-5-sulfamoylbenzoate (PubChem CID 16570421) has the molecular formula C16H17NO6S and a molecular weight of 351.38 g/mol. Its IUPAC name is (3-methoxyphenyl)methyl 2-methoxy-5-sulfamoylbenzoate.
| Compound Name | (3-methoxyphenyl)methyl 2-methoxy-5-sulfamoylbenzoate |
|---|---|
| PubChem CID | 16570421 |
| Molecular Formula | C16H17NO6S |
| Molecular Weight | 351.38 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | (3-methoxyphenyl)methyl 2-methoxy-5-sulfamoylbenzoate |
| SMILES | COc1cccc(COC(=O)c2cc(S(N)(=O)=O)ccc2OC)c1 |
| InChI | InChI=1S/C16H17NO6S/c1-21-12-5-3-4-11(8-12)10-23-16(18)14-9-13(24(17,19)20)6-7-15(14)22-2/h3-9H,10H2,1-2H3,(H2,17,19,20) |
| InChIKey | UPTDEKOJEXIDFP-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 104.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.38 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |