C19H18FN3O4S — CID 138994554
ethyl 4-[[2-(4-fluorophenyl)-5-methylpyrazol-3-yl]sulfamoyl]benzoate (PubChem CID 138994554) has the molecular formula C19H18FN3O4S and a molecular weight of 403.44 g/mol. Its IUPAC name is ethyl 4-[[2-(4-fluorophenyl)-5-methylpyrazol-3-yl]sulfamoyl]benzoate.
| Compound Name | ethyl 4-[[2-(4-fluorophenyl)-5-methylpyrazol-3-yl]sulfamoyl]benzoate |
|---|---|
| PubChem CID | 138994554 |
| Molecular Formula | C19H18FN3O4S |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | ethyl 4-[[2-(4-fluorophenyl)-5-methylpyrazol-3-yl]sulfamoyl]benzoate |
| SMILES | CCOC(=O)c1ccc(S(=O)(=O)Nc2cc(C)nn2-c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C19H18FN3O4S/c1-3-27-19(24)14-4-10-17(11-5-14)28(25,26)22-18-12-13(2)21-23(18)16-8-6-15(20)7-9-16/h4-12,22H,3H2,1-2H3 |
| InChIKey | WSXYZFSSWKPVAY-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |