(2R)-2-[(7-chloro-1,3-benzodioxol-5-yl)methoxy]propanoic acid

C11H11ClO5 — CID 104875465

IUPAC(2R)-2-[(7-chloro-1,3-benzodioxol-5-yl)methoxy]propanoic acid
SMILESC[C@@H](OCc1cc(Cl)c2c(c1)OCO2)C(=O)O
InChIInChI=1S/C11H11ClO5/c1-6(11(13)14)15-4-7-2-8(12)10-9(3-7)16-5-17-10/h2-3,6H,4-5H2,1H3,(H,13,14)/t6-/m1/s1
InChIKeyLFWOQQNFGZINTG-ZCFIWIBFSA-N
MW258.66 g/mol
LogP2.06
Rot. Bonds4

About (2R)-2-[(7-chloro-1,3-benzodioxol-5-yl)methoxy]propanoic acid

(2R)-2-[(7-chloro-1,3-benzodioxol-5-yl)methoxy]propanoic acid (PubChem CID 104875465) has the molecular formula C11H11ClO5 and a molecular weight of 258.66 g/mol. Its IUPAC name is (2R)-2-[(7-chloro-1,3-benzodioxol-5-yl)methoxy]propanoic acid.

Molecular Properties

Compound Name(2R)-2-[(7-chloro-1,3-benzodioxol-5-yl)methoxy]propanoic acid
PubChem CID104875465
Molecular FormulaC11H11ClO5
Molecular Weight258.66 g/mol
Exact Mass258.03
IUPAC Name(2R)-2-[(7-chloro-1,3-benzodioxol-5-yl)methoxy]propanoic acid
SMILESC[C@@H](OCc1cc(Cl)c2c(c1)OCO2)C(=O)O
InChIInChI=1S/C11H11ClO5/c1-6(11(13)14)15-4-7-2-8(12)10-9(3-7)16-5-17-10/h2-3,6H,4-5H2,1H3,(H,13,14)/t6-/m1/s1
InChIKeyLFWOQQNFGZINTG-ZCFIWIBFSA-N
XLogP2.06
TPSA64.99 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500258.66
LogP ≤ 52.06
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze (2R)-2-[(7-chloro-1,3-benzodioxol-5-yl)methoxy]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2R)-2-[(7-chloro-1,3-benzodioxol-5-yl)methoxy]propanoic acid?
The IUPAC name of (2R)-2-[(7-chloro-1,3-benzodioxol-5-yl)methoxy]propanoic acid (CID 104875465) is (2R)-2-[(7-chloro-1,3-benzodioxol-5-yl)methoxy]propanoic acid.
What is the SMILES notation for (2R)-2-[(7-chloro-1,3-benzodioxol-5-yl)methoxy]propanoic acid?
The canonical SMILES for (2R)-2-[(7-chloro-1,3-benzodioxol-5-yl)methoxy]propanoic acid is C[C@@H](OCc1cc(Cl)c2c(c1)OCO2)C(=O)O.
What is the InChIKey of (2R)-2-[(7-chloro-1,3-benzodioxol-5-yl)methoxy]propanoic acid?
The InChIKey is LFWOQQNFGZINTG-ZCFIWIBFSA-N. The full InChI is InChI=1S/C11H11ClO5/c1-6(11(13)14)15-4-7-2-8(12)10-9(3-7)16-5-17-10/h2-3,6H,4-5H2,1H3,(H,13,14)/t6-/m1/s1.
What are the key properties of (2R)-2-[(7-chloro-1,3-benzodioxol-5-yl)methoxy]propanoic acid?
(2R)-2-[(7-chloro-1,3-benzodioxol-5-yl)methoxy]propanoic acid has a molecular weight of 258.66 g/mol, XLogP of 2.06, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-[(7-chloro-1,3-benzodioxol-5-yl)methoxy]propanoic acid is sourced from PubChem (CID 104875465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).