C11H11ClO5 — CID 104875465
(2R)-2-[(7-chloro-1,3-benzodioxol-5-yl)methoxy]propanoic acid (PubChem CID 104875465) has the molecular formula C11H11ClO5 and a molecular weight of 258.66 g/mol. Its IUPAC name is (2R)-2-[(7-chloro-1,3-benzodioxol-5-yl)methoxy]propanoic acid.
| Compound Name | (2R)-2-[(7-chloro-1,3-benzodioxol-5-yl)methoxy]propanoic acid |
|---|---|
| PubChem CID | 104875465 |
| Molecular Formula | C11H11ClO5 |
| Molecular Weight | 258.66 g/mol |
| Exact Mass | 258.03 |
| IUPAC Name | (2R)-2-[(7-chloro-1,3-benzodioxol-5-yl)methoxy]propanoic acid |
| SMILES | C[C@@H](OCc1cc(Cl)c2c(c1)OCO2)C(=O)O |
| InChI | InChI=1S/C11H11ClO5/c1-6(11(13)14)15-4-7-2-8(12)10-9(3-7)16-5-17-10/h2-3,6H,4-5H2,1H3,(H,13,14)/t6-/m1/s1 |
| InChIKey | LFWOQQNFGZINTG-ZCFIWIBFSA-N |
| XLogP | 2.06 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.66 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |