C15H20ClNO4 — CID 65290176
6-[(7-chloro-1,3-benzodioxol-5-yl)methylamino]-4-methylhexanoic acid (PubChem CID 65290176) has the molecular formula C15H20ClNO4 and a molecular weight of 313.78 g/mol. Its IUPAC name is 6-[(7-chloro-1,3-benzodioxol-5-yl)methylamino]-4-methylhexanoic acid.
| Compound Name | 6-[(7-chloro-1,3-benzodioxol-5-yl)methylamino]-4-methylhexanoic acid |
|---|---|
| PubChem CID | 65290176 |
| Molecular Formula | C15H20ClNO4 |
| Molecular Weight | 313.78 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 6-[(7-chloro-1,3-benzodioxol-5-yl)methylamino]-4-methylhexanoic acid |
| SMILES | CC(CCNCc1cc(Cl)c2c(c1)OCO2)CCC(=O)O |
| InChI | InChI=1S/C15H20ClNO4/c1-10(2-3-14(18)19)4-5-17-8-11-6-12(16)15-13(7-11)20-9-21-15/h6-7,10,17H,2-5,8-9H2,1H3,(H,18,19) |
| InChIKey | QJSYRMMPOJELKU-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.78 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|