C25H19N3O4 — CID 18279019
(1,3-diphenylpyrazol-4-yl)methyl 2-(2-oxo-1,3-benzoxazol-3-yl)acetate (PubChem CID 18279019) has the molecular formula C25H19N3O4 and a molecular weight of 425.44 g/mol. Its IUPAC name is (1,3-diphenylpyrazol-4-yl)methyl 2-(2-oxo-1,3-benzoxazol-3-yl)acetate.
| Compound Name | (1,3-diphenylpyrazol-4-yl)methyl 2-(2-oxo-1,3-benzoxazol-3-yl)acetate |
|---|---|
| PubChem CID | 18279019 |
| Molecular Formula | C25H19N3O4 |
| Molecular Weight | 425.44 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | (1,3-diphenylpyrazol-4-yl)methyl 2-(2-oxo-1,3-benzoxazol-3-yl)acetate |
| SMILES | O=C(Cn1c(=O)oc2ccccc21)OCc1cn(-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C25H19N3O4/c29-23(16-27-21-13-7-8-14-22(21)32-25(27)30)31-17-19-15-28(20-11-5-2-6-12-20)26-24(19)18-9-3-1-4-10-18/h1-15H,16-17H2 |
| InChIKey | YGNRHPBTPKDTNN-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 79.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.44 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |