(1,3-diphenylpyrazol-4-yl)methyl 2-methoxyacetate

C19H18N2O3 — CID 7700000

IUPAC(1,3-diphenylpyrazol-4-yl)methyl 2-methoxyacetate
SMILESCOCC(=O)OCc1cn(-c2ccccc2)nc1-c1ccccc1
InChIInChI=1S/C19H18N2O3/c1-23-14-18(22)24-13-16-12-21(17-10-6-3-7-11-17)20-19(16)15-8-4-2-5-9-15/h2-12H,13-14H2,1H3
InChIKeyJLRRYXXGLXDSTE-UHFFFAOYSA-N
MW322.36 g/mol
LogP3.23
Rot. Bonds6

About (1,3-diphenylpyrazol-4-yl)methyl 2-methoxyacetate

(1,3-diphenylpyrazol-4-yl)methyl 2-methoxyacetate (PubChem CID 7700000) has the molecular formula C19H18N2O3 and a molecular weight of 322.36 g/mol. Its IUPAC name is (1,3-diphenylpyrazol-4-yl)methyl 2-methoxyacetate.

Molecular Properties

Compound Name(1,3-diphenylpyrazol-4-yl)methyl 2-methoxyacetate
PubChem CID7700000
Molecular FormulaC19H18N2O3
Molecular Weight322.36 g/mol
Exact Mass322.13
IUPAC Name(1,3-diphenylpyrazol-4-yl)methyl 2-methoxyacetate
SMILESCOCC(=O)OCc1cn(-c2ccccc2)nc1-c1ccccc1
InChIInChI=1S/C19H18N2O3/c1-23-14-18(22)24-13-16-12-21(17-10-6-3-7-11-17)20-19(16)15-8-4-2-5-9-15/h2-12H,13-14H2,1H3
InChIKeyJLRRYXXGLXDSTE-UHFFFAOYSA-N
XLogP3.23
TPSA53.35 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms24
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500322.36
LogP ≤ 53.23
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze (1,3-diphenylpyrazol-4-yl)methyl 2-methoxyacetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (1,3-diphenylpyrazol-4-yl)methyl 2-methoxyacetate?
The IUPAC name of (1,3-diphenylpyrazol-4-yl)methyl 2-methoxyacetate (CID 7700000) is (1,3-diphenylpyrazol-4-yl)methyl 2-methoxyacetate.
What is the SMILES notation for (1,3-diphenylpyrazol-4-yl)methyl 2-methoxyacetate?
The canonical SMILES for (1,3-diphenylpyrazol-4-yl)methyl 2-methoxyacetate is COCC(=O)OCc1cn(-c2ccccc2)nc1-c1ccccc1.
What is the InChIKey of (1,3-diphenylpyrazol-4-yl)methyl 2-methoxyacetate?
The InChIKey is JLRRYXXGLXDSTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18N2O3/c1-23-14-18(22)24-13-16-12-21(17-10-6-3-7-11-17)20-19(16)15-8-4-2-5-9-15/h2-12H,13-14H2,1H3.
What are the key properties of (1,3-diphenylpyrazol-4-yl)methyl 2-methoxyacetate?
(1,3-diphenylpyrazol-4-yl)methyl 2-methoxyacetate has a molecular weight of 322.36 g/mol, XLogP of 3.23, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1,3-diphenylpyrazol-4-yl)methyl 2-methoxyacetate is sourced from PubChem (CID 7700000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).