C27H21N3O4 — CID 55392353
(1,3-diphenylpyrazol-4-yl)methyl 4-(2,5-dioxopyrrolidin-1-yl)benzoate (PubChem CID 55392353) has the molecular formula C27H21N3O4 and a molecular weight of 451.48 g/mol. Its IUPAC name is (1,3-diphenylpyrazol-4-yl)methyl 4-(2,5-dioxopyrrolidin-1-yl)benzoate.
| Compound Name | (1,3-diphenylpyrazol-4-yl)methyl 4-(2,5-dioxopyrrolidin-1-yl)benzoate |
|---|---|
| PubChem CID | 55392353 |
| Molecular Formula | C27H21N3O4 |
| Molecular Weight | 451.48 g/mol |
| Exact Mass | 451.15 |
| IUPAC Name | (1,3-diphenylpyrazol-4-yl)methyl 4-(2,5-dioxopyrrolidin-1-yl)benzoate |
| SMILES | O=C(OCc1cn(-c2ccccc2)nc1-c1ccccc1)c1ccc(N2C(=O)CCC2=O)cc1 |
| InChI | InChI=1S/C27H21N3O4/c31-24-15-16-25(32)30(24)23-13-11-20(12-14-23)27(33)34-18-21-17-29(22-9-5-2-6-10-22)28-26(21)19-7-3-1-4-8-19/h1-14,17H,15-16,18H2 |
| InChIKey | UVJJNPFRKIYFLS-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.48 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|