C27H26N2O3 — CID 2505023
[3-(3,4-dimethylphenyl)-1-phenylpyrazol-4-yl]methyl 4-ethoxybenzoate (PubChem CID 2505023) has the molecular formula C27H26N2O3 and a molecular weight of 426.52 g/mol. Its IUPAC name is [3-(3,4-dimethylphenyl)-1-phenylpyrazol-4-yl]methyl 4-ethoxybenzoate.
| Compound Name | [3-(3,4-dimethylphenyl)-1-phenylpyrazol-4-yl]methyl 4-ethoxybenzoate |
|---|---|
| PubChem CID | 2505023 |
| Molecular Formula | C27H26N2O3 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | [3-(3,4-dimethylphenyl)-1-phenylpyrazol-4-yl]methyl 4-ethoxybenzoate |
| SMILES | CCOc1ccc(C(=O)OCc2cn(-c3ccccc3)nc2-c2ccc(C)c(C)c2)cc1 |
| InChI | InChI=1S/C27H26N2O3/c1-4-31-25-14-12-21(13-15-25)27(30)32-18-23-17-29(24-8-6-5-7-9-24)28-26(23)22-11-10-19(2)20(3)16-22/h5-17H,4,18H2,1-3H3 |
| InChIKey | QEMZNNDODJBAGP-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |