C26H24N2O3 — CID 7703542
(1,3-diphenylpyrazol-4-yl)methyl 3-(4-methylphenoxy)propanoate (PubChem CID 7703542) has the molecular formula C26H24N2O3 and a molecular weight of 412.49 g/mol. Its IUPAC name is (1,3-diphenylpyrazol-4-yl)methyl 3-(4-methylphenoxy)propanoate.
| Compound Name | (1,3-diphenylpyrazol-4-yl)methyl 3-(4-methylphenoxy)propanoate |
|---|---|
| PubChem CID | 7703542 |
| Molecular Formula | C26H24N2O3 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | (1,3-diphenylpyrazol-4-yl)methyl 3-(4-methylphenoxy)propanoate |
| SMILES | Cc1ccc(OCCC(=O)OCc2cn(-c3ccccc3)nc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C26H24N2O3/c1-20-12-14-24(15-13-20)30-17-16-25(29)31-19-22-18-28(23-10-6-3-7-11-23)27-26(22)21-8-4-2-5-9-21/h2-15,18H,16-17,19H2,1H3 |
| InChIKey | HNMNQNMXNYIWHA-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |