C27H26N2O2 — CID 2119337
(1,3-diphenylpyrazol-4-yl)methyl 4-tert-butylbenzoate (PubChem CID 2119337) has the molecular formula C27H26N2O2 and a molecular weight of 410.52 g/mol. Its IUPAC name is (1,3-diphenylpyrazol-4-yl)methyl 4-tert-butylbenzoate.
| Compound Name | (1,3-diphenylpyrazol-4-yl)methyl 4-tert-butylbenzoate |
|---|---|
| PubChem CID | 2119337 |
| Molecular Formula | C27H26N2O2 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | (1,3-diphenylpyrazol-4-yl)methyl 4-tert-butylbenzoate |
| SMILES | CC(C)(C)c1ccc(C(=O)OCc2cn(-c3ccccc3)nc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C27H26N2O2/c1-27(2,3)23-16-14-21(15-17-23)26(30)31-19-22-18-29(24-12-8-5-9-13-24)28-25(22)20-10-6-4-7-11-20/h4-18H,19H2,1-3H3 |
| InChIKey | QGGLMSBYYDEGJQ-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |