C21H19NO5S — CID 30404836
(2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl 3-(thiophene-3-carbonylamino)propanoate (PubChem CID 30404836) has the molecular formula C21H19NO5S and a molecular weight of 397.45 g/mol. Its IUPAC name is (2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl 3-(thiophene-3-carbonylamino)propanoate.
| Compound Name | (2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl 3-(thiophene-3-carbonylamino)propanoate |
|---|---|
| PubChem CID | 30404836 |
| Molecular Formula | C21H19NO5S |
| Molecular Weight | 397.45 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | (2-oxo-7,8-dihydro-6H-cyclopenta[g]chromen-4-yl)methyl 3-(thiophene-3-carbonylamino)propanoate |
| SMILES | O=C(CCNC(=O)c1ccsc1)OCc1cc(=O)oc2cc3c(cc12)CCC3 |
| InChI | InChI=1S/C21H19NO5S/c23-19(4-6-22-21(25)15-5-7-28-12-15)26-11-16-10-20(24)27-18-9-14-3-1-2-13(14)8-17(16)18/h5,7-10,12H,1-4,6,11H2,(H,22,25) |
| InChIKey | JUGFOYJNFADESF-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.45 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|