C24H25NO6S — CID 2129098
(7-methyl-2-oxochromen-4-yl)methyl (2R)-2-[(2-methoxybenzoyl)amino]-4-methylsulfanylbutanoate (PubChem CID 2129098) has the molecular formula C24H25NO6S and a molecular weight of 455.53 g/mol. Its IUPAC name is (7-methyl-2-oxochromen-4-yl)methyl (2R)-2-[(2-methoxybenzoyl)amino]-4-methylsulfanylbutanoate.
| Compound Name | (7-methyl-2-oxochromen-4-yl)methyl (2R)-2-[(2-methoxybenzoyl)amino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 2129098 |
| Molecular Formula | C24H25NO6S |
| Molecular Weight | 455.53 g/mol |
| Exact Mass | 455.14 |
| IUPAC Name | (7-methyl-2-oxochromen-4-yl)methyl (2R)-2-[(2-methoxybenzoyl)amino]-4-methylsulfanylbutanoate |
| SMILES | COc1ccccc1C(=O)N[C@H](CCSC)C(=O)OCc1cc(=O)oc2cc(C)ccc12 |
| InChI | InChI=1S/C24H25NO6S/c1-15-8-9-17-16(13-22(26)31-21(17)12-15)14-30-24(28)19(10-11-32-3)25-23(27)18-6-4-5-7-20(18)29-2/h4-9,12-13,19H,10-11,14H2,1-3H3,(H,25,27)/t19-/m1/s1 |
| InChIKey | XLSYVQBZSONJBE-LJQANCHMSA-N |
| XLogP | 3.70 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.53 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|