C23H21Cl2NO5S — CID 46793430
(6-chloro-7-methyl-2-oxochromen-4-yl)methyl 2-[(2-chlorobenzoyl)amino]-4-methylsulfanylbutanoate (PubChem CID 46793430) has the molecular formula C23H21Cl2NO5S and a molecular weight of 494.40 g/mol. Its IUPAC name is (6-chloro-7-methyl-2-oxochromen-4-yl)methyl 2-[(2-chlorobenzoyl)amino]-4-methylsulfanylbutanoate.
| Compound Name | (6-chloro-7-methyl-2-oxochromen-4-yl)methyl 2-[(2-chlorobenzoyl)amino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 46793430 |
| Molecular Formula | C23H21Cl2NO5S |
| Molecular Weight | 494.40 g/mol |
| Exact Mass | 493.05 |
| IUPAC Name | (6-chloro-7-methyl-2-oxochromen-4-yl)methyl 2-[(2-chlorobenzoyl)amino]-4-methylsulfanylbutanoate |
| SMILES | CSCCC(NC(=O)c1ccccc1Cl)C(=O)OCc1cc(=O)oc2cc(C)c(Cl)cc12 |
| InChI | InChI=1S/C23H21Cl2NO5S/c1-13-9-20-16(11-18(13)25)14(10-21(27)31-20)12-30-23(29)19(7-8-32-2)26-22(28)15-5-3-4-6-17(15)24/h3-6,9-11,19H,7-8,12H2,1-2H3,(H,26,28) |
| InChIKey | WIACNTFHCNWKGD-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.40 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|