C20H18ClFN2O3S — CID 55475176
(5-cyano-2-fluorophenyl)methyl 2-[(2-chlorobenzoyl)amino]-4-methylsulfanylbutanoate (PubChem CID 55475176) has the molecular formula C20H18ClFN2O3S and a molecular weight of 420.89 g/mol. Its IUPAC name is (5-cyano-2-fluorophenyl)methyl 2-[(2-chlorobenzoyl)amino]-4-methylsulfanylbutanoate.
| Compound Name | (5-cyano-2-fluorophenyl)methyl 2-[(2-chlorobenzoyl)amino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 55475176 |
| Molecular Formula | C20H18ClFN2O3S |
| Molecular Weight | 420.89 g/mol |
| Exact Mass | 420.07 |
| IUPAC Name | (5-cyano-2-fluorophenyl)methyl 2-[(2-chlorobenzoyl)amino]-4-methylsulfanylbutanoate |
| SMILES | CSCCC(NC(=O)c1ccccc1Cl)C(=O)OCc1cc(C#N)ccc1F |
| InChI | InChI=1S/C20H18ClFN2O3S/c1-28-9-8-18(24-19(25)15-4-2-3-5-16(15)21)20(26)27-12-14-10-13(11-23)6-7-17(14)22/h2-7,10,18H,8-9,12H2,1H3,(H,24,25) |
| InChIKey | XQSBNURCVGTFOY-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.89 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |