C20H19ClN2O3S — CID 7906553
(3-cyanophenyl)methyl (2R)-2-[(4-chlorobenzoyl)amino]-4-methylsulfanylbutanoate (PubChem CID 7906553) has the molecular formula C20H19ClN2O3S and a molecular weight of 402.90 g/mol. Its IUPAC name is (3-cyanophenyl)methyl (2R)-2-[(4-chlorobenzoyl)amino]-4-methylsulfanylbutanoate.
| Compound Name | (3-cyanophenyl)methyl (2R)-2-[(4-chlorobenzoyl)amino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 7906553 |
| Molecular Formula | C20H19ClN2O3S |
| Molecular Weight | 402.90 g/mol |
| Exact Mass | 402.08 |
| IUPAC Name | (3-cyanophenyl)methyl (2R)-2-[(4-chlorobenzoyl)amino]-4-methylsulfanylbutanoate |
| SMILES | CSCC[C@@H](NC(=O)c1ccc(Cl)cc1)C(=O)OCc1cccc(C#N)c1 |
| InChI | InChI=1S/C20H19ClN2O3S/c1-27-10-9-18(23-19(24)16-5-7-17(21)8-6-16)20(25)26-13-15-4-2-3-14(11-15)12-22/h2-8,11,18H,9-10,13H2,1H3,(H,23,24)/t18-/m1/s1 |
| InChIKey | HAPOUEIRFOYRIB-GOSISDBHSA-N |
| XLogP | 3.81 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.90 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |