C14H19Cl2N5O7 — CID 54605664
1,4-bis(2-chloroethyl)piperazine;2,4,6-trinitrophenol (PubChem CID 54605664) has the molecular formula C14H19Cl2N5O7 and a molecular weight of 440.24 g/mol. Its IUPAC name is 1,4-bis(2-chloroethyl)piperazine;2,4,6-trinitrophenol.
| Compound Name | 1,4-bis(2-chloroethyl)piperazine;2,4,6-trinitrophenol |
|---|---|
| PubChem CID | 54605664 |
| Molecular Formula | C14H19Cl2N5O7 |
| Molecular Weight | 440.24 g/mol |
| Exact Mass | 439.07 |
| IUPAC Name | 1,4-bis(2-chloroethyl)piperazine;2,4,6-trinitrophenol |
| SMILES | ClCCN1CCN(CCCl)CC1.O=[N+]([O-])c1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C8H16Cl2N2.C6H3N3O7/c9-1-3-11-5-7-12(4-2-10)8-6-11;10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16/h1-8H2;1-2,10H |
| InChIKey | ZYZKXTUWMPKCCT-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 156.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.24 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|