C14H19F2N3O2 — CID 166090592
1-[[2-(difluoromethyl)-4-nitrophenyl]methyl]-4-ethylpiperazine (PubChem CID 166090592) has the molecular formula C14H19F2N3O2 and a molecular weight of 299.32 g/mol. Its IUPAC name is 1-[[2-(difluoromethyl)-4-nitrophenyl]methyl]-4-ethylpiperazine.
| Compound Name | 1-[[2-(difluoromethyl)-4-nitrophenyl]methyl]-4-ethylpiperazine |
|---|---|
| PubChem CID | 166090592 |
| Molecular Formula | C14H19F2N3O2 |
| Molecular Weight | 299.32 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | 1-[[2-(difluoromethyl)-4-nitrophenyl]methyl]-4-ethylpiperazine |
| SMILES | CCN1CCN(Cc2ccc([N+](=O)[O-])cc2C(F)F)CC1 |
| InChI | InChI=1S/C14H19F2N3O2/c1-2-17-5-7-18(8-6-17)10-11-3-4-12(19(20)21)9-13(11)14(15)16/h3-4,9,14H,2,5-8,10H2,1H3 |
| InChIKey | RTOMMRHWUGUCQG-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 49.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.32 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|