C15H22FN3O3S — CID 161065058
tert-butyl 4-(5-carbamoyl-4-fluorothiophen-2-yl)-2-methylpiperazine-1-carboxylate (PubChem CID 161065058) has the molecular formula C15H22FN3O3S and a molecular weight of 343.42 g/mol. Its IUPAC name is tert-butyl 4-(5-carbamoyl-4-fluorothiophen-2-yl)-2-methylpiperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(5-carbamoyl-4-fluorothiophen-2-yl)-2-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 161065058 |
| Molecular Formula | C15H22FN3O3S |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | tert-butyl 4-(5-carbamoyl-4-fluorothiophen-2-yl)-2-methylpiperazine-1-carboxylate |
| SMILES | CC1CN(c2cc(F)c(C(N)=O)s2)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H22FN3O3S/c1-9-8-18(11-7-10(16)12(23-11)13(17)20)5-6-19(9)14(21)22-15(2,3)4/h7,9H,5-6,8H2,1-4H3,(H2,17,20) |
| InChIKey | UDXKIKSFQAVVHX-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |