C19H27N5O — CID 133486542
2-methyl-1-[3-methyl-4-(6-methyl-2-pyridin-3-ylpyrimidin-4-yl)piperazin-1-yl]propan-2-ol (PubChem CID 133486542) has the molecular formula C19H27N5O and a molecular weight of 341.46 g/mol. Its IUPAC name is 2-methyl-1-[3-methyl-4-(6-methyl-2-pyridin-3-ylpyrimidin-4-yl)piperazin-1-yl]propan-2-ol.
| Compound Name | 2-methyl-1-[3-methyl-4-(6-methyl-2-pyridin-3-ylpyrimidin-4-yl)piperazin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 133486542 |
| Molecular Formula | C19H27N5O |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.22 |
| IUPAC Name | 2-methyl-1-[3-methyl-4-(6-methyl-2-pyridin-3-ylpyrimidin-4-yl)piperazin-1-yl]propan-2-ol |
| SMILES | Cc1cc(N2CCN(CC(C)(C)O)CC2C)nc(-c2cccnc2)n1 |
| InChI | InChI=1S/C19H27N5O/c1-14-10-17(22-18(21-14)16-6-5-7-20-11-16)24-9-8-23(12-15(24)2)13-19(3,4)25/h5-7,10-11,15,25H,8-9,12-13H2,1-4H3 |
| InChIKey | LDJQOXVQMSQSEP-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |