C26H37N5O4 — CID 155940183
4-[4-[1-(cyclopropylmethyl)piperidin-4-yl]piperidin-1-yl]-6-methyl-2-pyridin-3-ylpyrimidine;formic acid (PubChem CID 155940183) has the molecular formula C26H37N5O4 and a molecular weight of 483.61 g/mol. Its IUPAC name is 4-[4-[1-(cyclopropylmethyl)piperidin-4-yl]piperidin-1-yl]-6-methyl-2-pyridin-3-ylpyrimidine;formic acid.
| Compound Name | 4-[4-[1-(cyclopropylmethyl)piperidin-4-yl]piperidin-1-yl]-6-methyl-2-pyridin-3-ylpyrimidine;formic acid |
|---|---|
| PubChem CID | 155940183 |
| Molecular Formula | C26H37N5O4 |
| Molecular Weight | 483.61 g/mol |
| Exact Mass | 483.28 |
| IUPAC Name | 4-[4-[1-(cyclopropylmethyl)piperidin-4-yl]piperidin-1-yl]-6-methyl-2-pyridin-3-ylpyrimidine;formic acid |
| SMILES | Cc1cc(N2CCC(C3CCN(CC4CC4)CC3)CC2)nc(-c2cccnc2)n1.O=CO.O=CO |
| InChI | InChI=1S/C24H33N5.2CH2O2/c1-18-15-23(27-24(26-18)22-3-2-10-25-16-22)29-13-8-21(9-14-29)20-6-11-28(12-7-20)17-19-4-5-19;2*2-1-3/h2-3,10,15-16,19-21H,4-9,11-14,17H2,1H3;2*1H,(H,2,3) |
| InChIKey | WEZHJRCBPSMJBB-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.61 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|