C21H27N5 — CID 133344382
4-[4-(2-bicyclo[2.2.1]heptanyl)piperazin-1-yl]-6-methyl-2-pyridin-3-ylpyrimidine (PubChem CID 133344382) has the molecular formula C21H27N5 and a molecular weight of 349.48 g/mol. Its IUPAC name is 4-[4-(2-bicyclo[2.2.1]heptanyl)piperazin-1-yl]-6-methyl-2-pyridin-3-ylpyrimidine.
| Compound Name | 4-[4-(2-bicyclo[2.2.1]heptanyl)piperazin-1-yl]-6-methyl-2-pyridin-3-ylpyrimidine |
|---|---|
| PubChem CID | 133344382 |
| Molecular Formula | C21H27N5 |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.23 |
| IUPAC Name | 4-[4-(2-bicyclo[2.2.1]heptanyl)piperazin-1-yl]-6-methyl-2-pyridin-3-ylpyrimidine |
| SMILES | Cc1cc(N2CCN(C3CC4CCC3C4)CC2)nc(-c2cccnc2)n1 |
| InChI | InChI=1S/C21H27N5/c1-15-11-20(24-21(23-15)18-3-2-6-22-14-18)26-9-7-25(8-10-26)19-13-16-4-5-17(19)12-16/h2-3,6,11,14,16-17,19H,4-5,7-10,12-13H2,1H3 |
| InChIKey | FLBGWUMGFZYDMJ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 45.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |