C16H16BrN3 — CID 156650895
6-bromo-2-(3-methylpiperidin-1-yl)quinoline-4-carbonitrile (PubChem CID 156650895) has the molecular formula C16H16BrN3 and a molecular weight of 330.23 g/mol. Its IUPAC name is 6-bromo-2-(3-methylpiperidin-1-yl)quinoline-4-carbonitrile.
| Compound Name | 6-bromo-2-(3-methylpiperidin-1-yl)quinoline-4-carbonitrile |
|---|---|
| PubChem CID | 156650895 |
| Molecular Formula | C16H16BrN3 |
| Molecular Weight | 330.23 g/mol |
| Exact Mass | 329.05 |
| IUPAC Name | 6-bromo-2-(3-methylpiperidin-1-yl)quinoline-4-carbonitrile |
| SMILES | CC1CCCN(c2cc(C#N)c3cc(Br)ccc3n2)C1 |
| InChI | InChI=1S/C16H16BrN3/c1-11-3-2-6-20(10-11)16-7-12(9-18)14-8-13(17)4-5-15(14)19-16/h4-5,7-8,11H,2-3,6,10H2,1H3 |
| InChIKey | FWZOMQMWIQSVRF-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 39.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.23 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |