C14H18N2S — CID 43317154
N-(3-methylcyclohexyl)-1,3-benzothiazol-2-amine (PubChem CID 43317154) has the molecular formula C14H18N2S and a molecular weight of 246.38 g/mol. Its IUPAC name is N-(3-methylcyclohexyl)-1,3-benzothiazol-2-amine.
| Compound Name | N-(3-methylcyclohexyl)-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 43317154 |
| Molecular Formula | C14H18N2S |
| Molecular Weight | 246.38 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | N-(3-methylcyclohexyl)-1,3-benzothiazol-2-amine |
| SMILES | CC1CCCC(Nc2nc3ccccc3s2)C1 |
| InChI | InChI=1S/C14H18N2S/c1-10-5-4-6-11(9-10)15-14-16-12-7-2-3-8-13(12)17-14/h2-3,7-8,10-11H,4-6,9H2,1H3,(H,15,16) |
| InChIKey | MZABIQRZCRIMOA-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.38 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |