C16H20N2O2S — CID 70778453
N-(1,9-dioxaspiro[5.5]undecan-4-yl)-1,3-benzothiazol-2-amine (PubChem CID 70778453) has the molecular formula C16H20N2O2S and a molecular weight of 304.41 g/mol. Its IUPAC name is N-(1,9-dioxaspiro[5.5]undecan-4-yl)-1,3-benzothiazol-2-amine.
| Compound Name | N-(1,9-dioxaspiro[5.5]undecan-4-yl)-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 70778453 |
| Molecular Formula | C16H20N2O2S |
| Molecular Weight | 304.41 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | N-(1,9-dioxaspiro[5.5]undecan-4-yl)-1,3-benzothiazol-2-amine |
| SMILES | c1ccc2sc(NC3CCOC4(CCOCC4)C3)nc2c1 |
| InChI | InChI=1S/C16H20N2O2S/c1-2-4-14-13(3-1)18-15(21-14)17-12-5-8-20-16(11-12)6-9-19-10-7-16/h1-4,12H,5-11H2,(H,17,18) |
| InChIKey | CFRUGQOMNWHVPA-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.41 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |