3-(1,3-benzothiazol-2-ylamino)oxolane-3-carboxylic acid

C12H12N2O3S — CID 64890029

IUPAC3-(1,3-benzothiazol-2-ylamino)oxolane-3-carboxylic acid
SMILESO=C(O)C1(Nc2nc3ccccc3s2)CCOC1
InChIInChI=1S/C12H12N2O3S/c15-10(16)12(5-6-17-7-12)14-11-13-8-3-1-2-4-9(8)18-11/h1-4H,5-7H2,(H,13,14)(H,15,16)
InChIKeyMFQYSXAHSRHQAC-UHFFFAOYSA-N
MW264.31 g/mol
LogP1.95
Rot. Bonds3

About 3-(1,3-benzothiazol-2-ylamino)oxolane-3-carboxylic acid

3-(1,3-benzothiazol-2-ylamino)oxolane-3-carboxylic acid (PubChem CID 64890029) has the molecular formula C12H12N2O3S and a molecular weight of 264.31 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-ylamino)oxolane-3-carboxylic acid.

Molecular Properties

Compound Name3-(1,3-benzothiazol-2-ylamino)oxolane-3-carboxylic acid
PubChem CID64890029
Molecular FormulaC12H12N2O3S
Molecular Weight264.31 g/mol
Exact Mass264.06
IUPAC Name3-(1,3-benzothiazol-2-ylamino)oxolane-3-carboxylic acid
SMILESO=C(O)C1(Nc2nc3ccccc3s2)CCOC1
InChIInChI=1S/C12H12N2O3S/c15-10(16)12(5-6-17-7-12)14-11-13-8-3-1-2-4-9(8)18-11/h1-4H,5-7H2,(H,13,14)(H,15,16)
InChIKeyMFQYSXAHSRHQAC-UHFFFAOYSA-N
XLogP1.95
TPSA71.45 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500264.31
LogP ≤ 51.95
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze 3-(1,3-benzothiazol-2-ylamino)oxolane-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(1,3-benzothiazol-2-ylamino)oxolane-3-carboxylic acid?
The IUPAC name of 3-(1,3-benzothiazol-2-ylamino)oxolane-3-carboxylic acid (CID 64890029) is 3-(1,3-benzothiazol-2-ylamino)oxolane-3-carboxylic acid.
What is the SMILES notation for 3-(1,3-benzothiazol-2-ylamino)oxolane-3-carboxylic acid?
The canonical SMILES for 3-(1,3-benzothiazol-2-ylamino)oxolane-3-carboxylic acid is O=C(O)C1(Nc2nc3ccccc3s2)CCOC1.
What is the InChIKey of 3-(1,3-benzothiazol-2-ylamino)oxolane-3-carboxylic acid?
The InChIKey is MFQYSXAHSRHQAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O3S/c15-10(16)12(5-6-17-7-12)14-11-13-8-3-1-2-4-9(8)18-11/h1-4H,5-7H2,(H,13,14)(H,15,16).
What are the key properties of 3-(1,3-benzothiazol-2-ylamino)oxolane-3-carboxylic acid?
3-(1,3-benzothiazol-2-ylamino)oxolane-3-carboxylic acid has a molecular weight of 264.31 g/mol, XLogP of 1.95, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,3-benzothiazol-2-ylamino)oxolane-3-carboxylic acid is sourced from PubChem (CID 64890029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).