C12H12N2O3S — CID 64890029
3-(1,3-benzothiazol-2-ylamino)oxolane-3-carboxylic acid (PubChem CID 64890029) has the molecular formula C12H12N2O3S and a molecular weight of 264.31 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-ylamino)oxolane-3-carboxylic acid.
| Compound Name | 3-(1,3-benzothiazol-2-ylamino)oxolane-3-carboxylic acid |
|---|---|
| PubChem CID | 64890029 |
| Molecular Formula | C12H12N2O3S |
| Molecular Weight | 264.31 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | 3-(1,3-benzothiazol-2-ylamino)oxolane-3-carboxylic acid |
| SMILES | O=C(O)C1(Nc2nc3ccccc3s2)CCOC1 |
| InChI | InChI=1S/C12H12N2O3S/c15-10(16)12(5-6-17-7-12)14-11-13-8-3-1-2-4-9(8)18-11/h1-4H,5-7H2,(H,13,14)(H,15,16) |
| InChIKey | MFQYSXAHSRHQAC-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.31 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |