C16H19N3O3S2 — CID 166241433
3-[4-(1,3-benzothiazol-2-ylsulfanyl)butanoylamino]oxolane-3-carboxamide (PubChem CID 166241433) has the molecular formula C16H19N3O3S2 and a molecular weight of 365.48 g/mol. Its IUPAC name is 3-[4-(1,3-benzothiazol-2-ylsulfanyl)butanoylamino]oxolane-3-carboxamide.
| Compound Name | 3-[4-(1,3-benzothiazol-2-ylsulfanyl)butanoylamino]oxolane-3-carboxamide |
|---|---|
| PubChem CID | 166241433 |
| Molecular Formula | C16H19N3O3S2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | 3-[4-(1,3-benzothiazol-2-ylsulfanyl)butanoylamino]oxolane-3-carboxamide |
| SMILES | NC(=O)C1(NC(=O)CCCSc2nc3ccccc3s2)CCOC1 |
| InChI | InChI=1S/C16H19N3O3S2/c17-14(21)16(7-8-22-10-16)19-13(20)6-3-9-23-15-18-11-4-1-2-5-12(11)24-15/h1-2,4-5H,3,6-10H2,(H2,17,21)(H,19,20) |
| InChIKey | RWKJICUHHPQZTI-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|