C17H21N7 — CID 67906747
N-[1-[2-(pyrimidin-2-ylamino)ethyl]pyrrolidin-3-yl]-1H-benzimidazol-2-amine (PubChem CID 67906747) has the molecular formula C17H21N7 and a molecular weight of 323.40 g/mol. Its IUPAC name is N-[1-[2-(pyrimidin-2-ylamino)ethyl]pyrrolidin-3-yl]-1H-benzimidazol-2-amine.
| Compound Name | N-[1-[2-(pyrimidin-2-ylamino)ethyl]pyrrolidin-3-yl]-1H-benzimidazol-2-amine |
|---|---|
| PubChem CID | 67906747 |
| Molecular Formula | C17H21N7 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | N-[1-[2-(pyrimidin-2-ylamino)ethyl]pyrrolidin-3-yl]-1H-benzimidazol-2-amine |
| SMILES | c1cnc(NCCN2CCC(Nc3nc4ccccc4[nH]3)C2)nc1 |
| InChI | InChI=1S/C17H21N7/c1-2-5-15-14(4-1)22-17(23-15)21-13-6-10-24(12-13)11-9-20-16-18-7-3-8-19-16/h1-5,7-8,13H,6,9-12H2,(H,18,19,20)(H2,21,22,23) |
| InChIKey | OWALEVQPKUXJGH-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 81.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |