C16H16FN5S — CID 136539907
6-fluoro-N-[1-(1,3-thiazol-2-yl)piperidin-4-yl]quinazolin-4-amine (PubChem CID 136539907) has the molecular formula C16H16FN5S and a molecular weight of 329.40 g/mol. Its IUPAC name is 6-fluoro-N-[1-(1,3-thiazol-2-yl)piperidin-4-yl]quinazolin-4-amine.
| Compound Name | 6-fluoro-N-[1-(1,3-thiazol-2-yl)piperidin-4-yl]quinazolin-4-amine |
|---|---|
| PubChem CID | 136539907 |
| Molecular Formula | C16H16FN5S |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | 6-fluoro-N-[1-(1,3-thiazol-2-yl)piperidin-4-yl]quinazolin-4-amine |
| SMILES | Fc1ccc2ncnc(NC3CCN(c4nccs4)CC3)c2c1 |
| InChI | InChI=1S/C16H16FN5S/c17-11-1-2-14-13(9-11)15(20-10-19-14)21-12-3-6-22(7-4-12)16-18-5-8-23-16/h1-2,5,8-10,12H,3-4,6-7H2,(H,19,20,21) |
| InChIKey | OQNIGZSHTIVQCX-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |