C19H20FN5O — CID 126934861
2-[4-[(6-fluoroquinazolin-4-yl)amino]cyclohexyl]-6-methylpyridazin-3-one (PubChem CID 126934861) has the molecular formula C19H20FN5O and a molecular weight of 353.40 g/mol. Its IUPAC name is 2-[4-[(6-fluoroquinazolin-4-yl)amino]cyclohexyl]-6-methylpyridazin-3-one.
| Compound Name | 2-[4-[(6-fluoroquinazolin-4-yl)amino]cyclohexyl]-6-methylpyridazin-3-one |
|---|---|
| PubChem CID | 126934861 |
| Molecular Formula | C19H20FN5O |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | 2-[4-[(6-fluoroquinazolin-4-yl)amino]cyclohexyl]-6-methylpyridazin-3-one |
| SMILES | Cc1ccc(=O)n(C2CCC(Nc3ncnc4ccc(F)cc34)CC2)n1 |
| InChI | InChI=1S/C19H20FN5O/c1-12-2-9-18(26)25(24-12)15-6-4-14(5-7-15)23-19-16-10-13(20)3-8-17(16)21-11-22-19/h2-3,8-11,14-15H,4-7H2,1H3,(H,21,22,23) |
| InChIKey | VEOWBDDGKQFDBD-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |