C13H18FNO3S — CID 43730186
N-(2-ethoxy-4-fluorophenyl)-1,1-dioxothian-4-amine (PubChem CID 43730186) has the molecular formula C13H18FNO3S and a molecular weight of 287.36 g/mol. Its IUPAC name is N-(2-ethoxy-4-fluorophenyl)-1,1-dioxothian-4-amine.
| Compound Name | N-(2-ethoxy-4-fluorophenyl)-1,1-dioxothian-4-amine |
|---|---|
| PubChem CID | 43730186 |
| Molecular Formula | C13H18FNO3S |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | N-(2-ethoxy-4-fluorophenyl)-1,1-dioxothian-4-amine |
| SMILES | CCOc1cc(F)ccc1NC1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C13H18FNO3S/c1-2-18-13-9-10(14)3-4-12(13)15-11-5-7-19(16,17)8-6-11/h3-4,9,11,15H,2,5-8H2,1H3 |
| InChIKey | VSDRXVJTPUZIHA-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |