C18H21N — CID 43687471
N-(2-propylphenyl)-2,3-dihydro-1H-inden-2-amine (PubChem CID 43687471) has the molecular formula C18H21N and a molecular weight of 251.37 g/mol. Its IUPAC name is N-(2-propylphenyl)-2,3-dihydro-1H-inden-2-amine.
| Compound Name | N-(2-propylphenyl)-2,3-dihydro-1H-inden-2-amine |
|---|---|
| PubChem CID | 43687471 |
| Molecular Formula | C18H21N |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | N-(2-propylphenyl)-2,3-dihydro-1H-inden-2-amine |
| SMILES | CCCc1ccccc1NC1Cc2ccccc2C1 |
| InChI | InChI=1S/C18H21N/c1-2-7-14-8-5-6-11-18(14)19-17-12-15-9-3-4-10-16(15)13-17/h3-6,8-11,17,19H,2,7,12-13H2,1H3 |
| InChIKey | JVWWHYVWYFZGGB-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |