C14H23FN4O — CID 83005171
4-fluoro-1-N-(4-methylpiperazin-1-yl)-5-propoxybenzene-1,2-diamine (PubChem CID 83005171) has the molecular formula C14H23FN4O and a molecular weight of 282.36 g/mol. Its IUPAC name is 4-fluoro-1-N-(4-methylpiperazin-1-yl)-5-propoxybenzene-1,2-diamine.
| Compound Name | 4-fluoro-1-N-(4-methylpiperazin-1-yl)-5-propoxybenzene-1,2-diamine |
|---|---|
| PubChem CID | 83005171 |
| Molecular Formula | C14H23FN4O |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | 4-fluoro-1-N-(4-methylpiperazin-1-yl)-5-propoxybenzene-1,2-diamine |
| SMILES | CCCOc1cc(NN2CCN(C)CC2)c(N)cc1F |
| InChI | InChI=1S/C14H23FN4O/c1-3-8-20-14-10-13(12(16)9-11(14)15)17-19-6-4-18(2)5-7-19/h9-10,17H,3-8,16H2,1-2H3 |
| InChIKey | YXGDADCLHZEQAO-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 53.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|