C16H29N3OS — CID 107819531
3-amino-5-(2-ethylhexylamino)-N-propylthiophene-2-carboxamide (PubChem CID 107819531) has the molecular formula C16H29N3OS and a molecular weight of 311.50 g/mol. Its IUPAC name is 3-amino-5-(2-ethylhexylamino)-N-propylthiophene-2-carboxamide.
| Compound Name | 3-amino-5-(2-ethylhexylamino)-N-propylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 107819531 |
| Molecular Formula | C16H29N3OS |
| Molecular Weight | 311.50 g/mol |
| Exact Mass | 311.20 |
| IUPAC Name | 3-amino-5-(2-ethylhexylamino)-N-propylthiophene-2-carboxamide |
| SMILES | CCCCC(CC)CNc1cc(N)c(C(=O)NCCC)s1 |
| InChI | InChI=1S/C16H29N3OS/c1-4-7-8-12(6-3)11-19-14-10-13(17)15(21-14)16(20)18-9-5-2/h10,12,19H,4-9,11,17H2,1-3H3,(H,18,20) |
| InChIKey | BZFICXXDFXSGJU-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.50 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |