C15H28N4OS — CID 103425930
3-amino-5-[3-(diethylamino)propylamino]-N-propylthiophene-2-carboxamide (PubChem CID 103425930) has the molecular formula C15H28N4OS and a molecular weight of 312.48 g/mol. Its IUPAC name is 3-amino-5-[3-(diethylamino)propylamino]-N-propylthiophene-2-carboxamide.
| Compound Name | 3-amino-5-[3-(diethylamino)propylamino]-N-propylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 103425930 |
| Molecular Formula | C15H28N4OS |
| Molecular Weight | 312.48 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | 3-amino-5-[3-(diethylamino)propylamino]-N-propylthiophene-2-carboxamide |
| SMILES | CCCNC(=O)c1sc(NCCCN(CC)CC)cc1N |
| InChI | InChI=1S/C15H28N4OS/c1-4-8-18-15(20)14-12(16)11-13(21-14)17-9-7-10-19(5-2)6-3/h11,17H,4-10,16H2,1-3H3,(H,18,20) |
| InChIKey | YQWGWLMSNJVDFX-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.48 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|