C18H31NO2 — CID 63489493
3,4-diethoxy-N-(2-ethylhexyl)aniline (PubChem CID 63489493) has the molecular formula C18H31NO2 and a molecular weight of 293.45 g/mol. Its IUPAC name is 3,4-diethoxy-N-(2-ethylhexyl)aniline.
| Compound Name | 3,4-diethoxy-N-(2-ethylhexyl)aniline |
|---|---|
| PubChem CID | 63489493 |
| Molecular Formula | C18H31NO2 |
| Molecular Weight | 293.45 g/mol |
| Exact Mass | 293.24 |
| IUPAC Name | 3,4-diethoxy-N-(2-ethylhexyl)aniline |
| SMILES | CCCCC(CC)CNc1ccc(OCC)c(OCC)c1 |
| InChI | InChI=1S/C18H31NO2/c1-5-9-10-15(6-2)14-19-16-11-12-17(20-7-3)18(13-16)21-8-4/h11-13,15,19H,5-10,14H2,1-4H3 |
| InChIKey | KPKOPIRWWALRBF-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.45 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|