C8H10N4O2 — CID 61000286
3-(1H-pyrazol-4-ylmethylamino)pyrrolidine-2,5-dione (PubChem CID 61000286) has the molecular formula C8H10N4O2 and a molecular weight of 194.19 g/mol. Its IUPAC name is 3-(1H-pyrazol-4-ylmethylamino)pyrrolidine-2,5-dione.
| Compound Name | 3-(1H-pyrazol-4-ylmethylamino)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 61000286 |
| Molecular Formula | C8H10N4O2 |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.08 |
| IUPAC Name | 3-(1H-pyrazol-4-ylmethylamino)pyrrolidine-2,5-dione |
| SMILES | O=C1CC(NCc2cn[nH]c2)C(=O)N1 |
| InChI | InChI=1S/C8H10N4O2/c13-7-1-6(8(14)12-7)9-2-5-3-10-11-4-5/h3-4,6,9H,1-2H2,(H,10,11)(H,12,13,14) |
| InChIKey | XNOAOBPZDAWPDU-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|