C14H10N2O2 — CID 81428770
1-(quinolin-8-ylmethyl)pyrrole-2,5-dione (PubChem CID 81428770) has the molecular formula C14H10N2O2 and a molecular weight of 238.25 g/mol. Its IUPAC name is 1-(quinolin-8-ylmethyl)pyrrole-2,5-dione.
| Compound Name | 1-(quinolin-8-ylmethyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 81428770 |
| Molecular Formula | C14H10N2O2 |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | 1-(quinolin-8-ylmethyl)pyrrole-2,5-dione |
| SMILES | O=C1C=CC(=O)N1Cc1cccc2cccnc12 |
| InChI | InChI=1S/C14H10N2O2/c17-12-6-7-13(18)16(12)9-11-4-1-3-10-5-2-8-15-14(10)11/h1-8H,9H2 |
| InChIKey | CVYCIOTVBNJRLP-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|