C12H11N5 — CID 54929663
1-(quinolin-8-ylmethyl)-1,2,4-triazol-3-amine (PubChem CID 54929663) has the molecular formula C12H11N5 and a molecular weight of 225.26 g/mol. Its IUPAC name is 1-(quinolin-8-ylmethyl)-1,2,4-triazol-3-amine.
| Compound Name | 1-(quinolin-8-ylmethyl)-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 54929663 |
| Molecular Formula | C12H11N5 |
| Molecular Weight | 225.26 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | 1-(quinolin-8-ylmethyl)-1,2,4-triazol-3-amine |
| SMILES | Nc1ncn(Cc2cccc3cccnc23)n1 |
| InChI | InChI=1S/C12H11N5/c13-12-15-8-17(16-12)7-10-4-1-3-9-5-2-6-14-11(9)10/h1-6,8H,7H2,(H2,13,16) |
| InChIKey | KMLGSJIMBLARFB-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.26 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |