methyl 5-amino-1-(quinolin-8-ylmethyl)imidazole-4-carboxylate

C15H14N4O2 — CID 103545848

IUPACmethyl 5-amino-1-(quinolin-8-ylmethyl)imidazole-4-carboxylate
SMILESCOC(=O)c1ncn(Cc2cccc3cccnc23)c1N
InChIInChI=1S/C15H14N4O2/c1-21-15(20)13-14(16)19(9-18-13)8-11-5-2-4-10-6-3-7-17-12(10)11/h2-7,9H,8,16H2,1H3
InChIKeyLHXMLSHGCHZHJU-UHFFFAOYSA-N
MW282.30 g/mol
LogP1.85
Rot. Bonds3

About methyl 5-amino-1-(quinolin-8-ylmethyl)imidazole-4-carboxylate

methyl 5-amino-1-(quinolin-8-ylmethyl)imidazole-4-carboxylate (PubChem CID 103545848) has the molecular formula C15H14N4O2 and a molecular weight of 282.30 g/mol. Its IUPAC name is methyl 5-amino-1-(quinolin-8-ylmethyl)imidazole-4-carboxylate.

Molecular Properties

Compound Namemethyl 5-amino-1-(quinolin-8-ylmethyl)imidazole-4-carboxylate
PubChem CID103545848
Molecular FormulaC15H14N4O2
Molecular Weight282.30 g/mol
Exact Mass282.11
IUPAC Namemethyl 5-amino-1-(quinolin-8-ylmethyl)imidazole-4-carboxylate
SMILESCOC(=O)c1ncn(Cc2cccc3cccnc23)c1N
InChIInChI=1S/C15H14N4O2/c1-21-15(20)13-14(16)19(9-18-13)8-11-5-2-4-10-6-3-7-17-12(10)11/h2-7,9H,8,16H2,1H3
InChIKeyLHXMLSHGCHZHJU-UHFFFAOYSA-N
XLogP1.85
TPSA83.03 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds3
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500282.30
LogP ≤ 51.85
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Analyze methyl 5-amino-1-(quinolin-8-ylmethyl)imidazole-4-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 5-amino-1-(quinolin-8-ylmethyl)imidazole-4-carboxylate?
The IUPAC name of methyl 5-amino-1-(quinolin-8-ylmethyl)imidazole-4-carboxylate (CID 103545848) is methyl 5-amino-1-(quinolin-8-ylmethyl)imidazole-4-carboxylate.
What is the SMILES notation for methyl 5-amino-1-(quinolin-8-ylmethyl)imidazole-4-carboxylate?
The canonical SMILES for methyl 5-amino-1-(quinolin-8-ylmethyl)imidazole-4-carboxylate is COC(=O)c1ncn(Cc2cccc3cccnc23)c1N.
What is the InChIKey of methyl 5-amino-1-(quinolin-8-ylmethyl)imidazole-4-carboxylate?
The InChIKey is LHXMLSHGCHZHJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14N4O2/c1-21-15(20)13-14(16)19(9-18-13)8-11-5-2-4-10-6-3-7-17-12(10)11/h2-7,9H,8,16H2,1H3.
What are the key properties of methyl 5-amino-1-(quinolin-8-ylmethyl)imidazole-4-carboxylate?
methyl 5-amino-1-(quinolin-8-ylmethyl)imidazole-4-carboxylate has a molecular weight of 282.30 g/mol, XLogP of 1.85, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-amino-1-(quinolin-8-ylmethyl)imidazole-4-carboxylate is sourced from PubChem (CID 103545848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).