C21H17N3O3 — CID 134021250
3-oxo-N-[phenyl(pyridin-2-yl)methyl]-4H-1,4-benzoxazine-6-carboxamide (PubChem CID 134021250) has the molecular formula C21H17N3O3 and a molecular weight of 359.39 g/mol. Its IUPAC name is 3-oxo-N-[phenyl(pyridin-2-yl)methyl]-4H-1,4-benzoxazine-6-carboxamide.
| Compound Name | 3-oxo-N-[phenyl(pyridin-2-yl)methyl]-4H-1,4-benzoxazine-6-carboxamide |
|---|---|
| PubChem CID | 134021250 |
| Molecular Formula | C21H17N3O3 |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | 3-oxo-N-[phenyl(pyridin-2-yl)methyl]-4H-1,4-benzoxazine-6-carboxamide |
| SMILES | O=C1COc2ccc(C(=O)NC(c3ccccc3)c3ccccn3)cc2N1 |
| InChI | InChI=1S/C21H17N3O3/c25-19-13-27-18-10-9-15(12-17(18)23-19)21(26)24-20(14-6-2-1-3-7-14)16-8-4-5-11-22-16/h1-12,20H,13H2,(H,23,25)(H,24,26) |
| InChIKey | WYNJPYWONSDITA-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |