C18H17ClN2O6S — CID 29265060
7-chloro-N-(2-hydroxy-5-pyrrolidin-1-ylsulfonylphenyl)-1,3-benzodioxole-5-carboxamide (PubChem CID 29265060) has the molecular formula C18H17ClN2O6S and a molecular weight of 424.86 g/mol. Its IUPAC name is 7-chloro-N-(2-hydroxy-5-pyrrolidin-1-ylsulfonylphenyl)-1,3-benzodioxole-5-carboxamide.
| Compound Name | 7-chloro-N-(2-hydroxy-5-pyrrolidin-1-ylsulfonylphenyl)-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 29265060 |
| Molecular Formula | C18H17ClN2O6S |
| Molecular Weight | 424.86 g/mol |
| Exact Mass | 424.05 |
| IUPAC Name | 7-chloro-N-(2-hydroxy-5-pyrrolidin-1-ylsulfonylphenyl)-1,3-benzodioxole-5-carboxamide |
| SMILES | O=C(Nc1cc(S(=O)(=O)N2CCCC2)ccc1O)c1cc(Cl)c2c(c1)OCO2 |
| InChI | InChI=1S/C18H17ClN2O6S/c19-13-7-11(8-16-17(13)27-10-26-16)18(23)20-14-9-12(3-4-15(14)22)28(24,25)21-5-1-2-6-21/h3-4,7-9,22H,1-2,5-6,10H2,(H,20,23) |
| InChIKey | ITZNMEOQBXJTOL-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.86 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|