C22H23N3O7S — CID 43060173
1-(1,3-benzodioxol-5-yl)-N-(2-hydroxy-5-pyrrolidin-1-ylsulfonylphenyl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 43060173) has the molecular formula C22H23N3O7S and a molecular weight of 473.51 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-N-(2-hydroxy-5-pyrrolidin-1-ylsulfonylphenyl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-N-(2-hydroxy-5-pyrrolidin-1-ylsulfonylphenyl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 43060173 |
| Molecular Formula | C22H23N3O7S |
| Molecular Weight | 473.51 g/mol |
| Exact Mass | 473.13 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-N-(2-hydroxy-5-pyrrolidin-1-ylsulfonylphenyl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | O=C(Nc1cc(S(=O)(=O)N2CCCC2)ccc1O)C1CC(=O)N(c2ccc3c(c2)OCO3)C1 |
| InChI | InChI=1S/C22H23N3O7S/c26-18-5-4-16(33(29,30)24-7-1-2-8-24)11-17(18)23-22(28)14-9-21(27)25(12-14)15-3-6-19-20(10-15)32-13-31-19/h3-6,10-11,14,26H,1-2,7-9,12-13H2,(H,23,28) |
| InChIKey | PSOILQZUPNOCCQ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 125.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.51 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|