C18H17ClF3N3O5S — CID 55792224
5-chloro-N-(2-hydroxy-5-pyrrolidin-1-ylsulfonylphenyl)-6-(2,2,2-trifluoroethoxy)pyridine-3-carboxamide (PubChem CID 55792224) has the molecular formula C18H17ClF3N3O5S and a molecular weight of 479.86 g/mol. Its IUPAC name is 5-chloro-N-(2-hydroxy-5-pyrrolidin-1-ylsulfonylphenyl)-6-(2,2,2-trifluoroethoxy)pyridine-3-carboxamide.
| Compound Name | 5-chloro-N-(2-hydroxy-5-pyrrolidin-1-ylsulfonylphenyl)-6-(2,2,2-trifluoroethoxy)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 55792224 |
| Molecular Formula | C18H17ClF3N3O5S |
| Molecular Weight | 479.86 g/mol |
| Exact Mass | 479.05 |
| IUPAC Name | 5-chloro-N-(2-hydroxy-5-pyrrolidin-1-ylsulfonylphenyl)-6-(2,2,2-trifluoroethoxy)pyridine-3-carboxamide |
| SMILES | O=C(Nc1cc(S(=O)(=O)N2CCCC2)ccc1O)c1cnc(OCC(F)(F)F)c(Cl)c1 |
| InChI | InChI=1S/C18H17ClF3N3O5S/c19-13-7-11(9-23-17(13)30-10-18(20,21)22)16(27)24-14-8-12(3-4-15(14)26)31(28,29)25-5-1-2-6-25/h3-4,7-9,26H,1-2,5-6,10H2,(H,24,27) |
| InChIKey | VQGALGWCCQQODA-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 108.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.86 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|