C20H21ClN2O5S — CID 39755188
N-[3-(azepan-1-ylsulfonyl)phenyl]-7-chloro-1,3-benzodioxole-5-carboxamide (PubChem CID 39755188) has the molecular formula C20H21ClN2O5S and a molecular weight of 436.92 g/mol. Its IUPAC name is N-[3-(azepan-1-ylsulfonyl)phenyl]-7-chloro-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[3-(azepan-1-ylsulfonyl)phenyl]-7-chloro-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 39755188 |
| Molecular Formula | C20H21ClN2O5S |
| Molecular Weight | 436.92 g/mol |
| Exact Mass | 436.09 |
| IUPAC Name | N-[3-(azepan-1-ylsulfonyl)phenyl]-7-chloro-1,3-benzodioxole-5-carboxamide |
| SMILES | O=C(Nc1cccc(S(=O)(=O)N2CCCCCC2)c1)c1cc(Cl)c2c(c1)OCO2 |
| InChI | InChI=1S/C20H21ClN2O5S/c21-17-10-14(11-18-19(17)28-13-27-18)20(24)22-15-6-5-7-16(12-15)29(25,26)23-8-3-1-2-4-9-23/h5-7,10-12H,1-4,8-9,13H2,(H,22,24) |
| InChIKey | GKVZDCCGSXOHCU-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.92 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |