C17H14F6N4O — CID 11553181
N-[3-(diaminomethylideneamino)-4-methylphenyl]-3,5-bis(trifluoromethyl)benzamide (PubChem CID 11553181) has the molecular formula C17H14F6N4O and a molecular weight of 404.31 g/mol. Its IUPAC name is N-[3-(diaminomethylideneamino)-4-methylphenyl]-3,5-bis(trifluoromethyl)benzamide.
| Compound Name | N-[3-(diaminomethylideneamino)-4-methylphenyl]-3,5-bis(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 11553181 |
| Molecular Formula | C17H14F6N4O |
| Molecular Weight | 404.31 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | N-[3-(diaminomethylideneamino)-4-methylphenyl]-3,5-bis(trifluoromethyl)benzamide |
| SMILES | Cc1ccc(NC(=O)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1N=C(N)N |
| InChI | InChI=1S/C17H14F6N4O/c1-8-2-3-12(7-13(8)27-15(24)25)26-14(28)9-4-10(16(18,19)20)6-11(5-9)17(21,22)23/h2-7H,1H3,(H,26,28)(H4,24,25,27) |
| InChIKey | MNSFGOXAJUTTPN-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.31 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|